CymitQuimica logo

CAS 185039-48-9

:

6-(2,6-dichlorophenyl)-8-methyl-2-(methylsulfonyl)pyrido[2,3-d]pyrimidin-7(8H)-one

Description:
6-(2,6-Dichlorophenyl)-8-methyl-2-(methylsulfonyl)pyrido[2,3-d]pyrimidin-7(8H)-one, with the CAS number 185039-48-9, is a synthetic organic compound characterized by its complex heterocyclic structure. It features a pyrido[2,3-d]pyrimidine core, which is a fused bicyclic system that incorporates nitrogen atoms, contributing to its potential biological activity. The presence of a dichlorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. Additionally, the methylsulfonyl group is known for its role in enhancing solubility and stability. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its unique structural features suggest potential applications in various fields, including pharmaceuticals and agrochemicals. As with many synthetic compounds, understanding its reactivity, stability, and interaction with biological systems is crucial for assessing its utility and safety in practical applications.
Formula:C15H11Cl2N3O3S
InChI:InChI=1/C15H11Cl2N3O3S/c1-20-13-8(7-18-15(19-13)24(2,22)23)6-9(14(20)21)12-10(16)4-3-5-11(12)17/h3-7H,1-2H3
InChI key:BADVXFUKYQHVBO-UHFFFAOYSA-N
SMILES:Cn1c2c(cc(c3c(cccc3Cl)Cl)c1=O)cnc(n2)S(=O)(=O)C
Found 2 products.