CAS 18511-69-8
:2,2'-bipyridine-4,4'-diamine
Description:
2,2'-Bipyridine-4,4'-diamine, with the CAS number 18511-69-8, is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. This compound features amino groups (-NH2) at the 4 and 4' positions of the bipyridine framework, contributing to its potential as a ligand in coordination chemistry. The presence of these amino groups enhances its solubility in polar solvents and allows for the formation of various metal complexes, making it valuable in catalysis and materials science. 2,2'-Bipyridine-4,4'-diamine exhibits properties typical of amines, such as basicity and the ability to participate in hydrogen bonding. Its molecular structure allows for various functionalization possibilities, which can lead to diverse applications in organic synthesis and as a building block in the development of pharmaceuticals and agrochemicals. Additionally, the compound's stability and reactivity can be influenced by the surrounding environment, including pH and the presence of metal ions.
Formula:C10H10N4
InChI:InChI=1/C10H10N4/c11-7-1-3-13-9(5-7)10-6-8(12)2-4-14-10/h1-6H,(H2,11,13)(H2,12,14)
SMILES:c1cnc(cc1N)c1cc(ccn1)N
Synonyms:- 4,4'-Diamino-[2,2']-Bipyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4,4'-Diamino-2,2'-bipyridyl
CAS:Formula:C10H10N4Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:186.224,4'-Diamino-2,2'-bipyridine
CAS:4,4'-Diamino-2,2'-bipyridineFormula:C10H10N4Purity:97%Color and Shape:Solid-PowderMolecular weight:186.21324,4'-DIAMINO-2,2'-BIPYRIDINE
CAS:Formula:C10H10N4Purity:95%Color and Shape:SolidMolecular weight:186.2132[2,2′-Bipyridine]-4,4′-diamine
CAS:Formula:C10H10N4Purity:97%Color and Shape:Solid, White - Slightly pale yellow powderMolecular weight:186.2184,4'-Diamino-2,2'-bipyridine
CAS:Controlled ProductApplications 4,4'-Diamino-2,2'-bipyridine is a bidendate chelator.
Formula:C10H10N4Color and Shape:NeatMolecular weight:186.214,4'-Diamino-2,2'-bipyridine
CAS:4,4'-Diamino-2,2'-bipyridine (DABP) is a redox-active compound that is synthesized to be used as a single-stranded DNA probe. It has been shown to have high affinity for nucleic acids and can be used in many applications including the detection of mutations in human ovarian carcinoma cells. DABP can also be used as a model protein for studying interactions with other biomolecules. The immobilization of DABP on an electrode surface allows for the study of its electrochemical properties. This includes the correlation between the redox potential and luminescence intensity and the dependence on pH or ionic strength. DABP can also be used to detect oxygen concentration or ATP levels in mitochondria through its ability to absorb light at wavelengths from 400 nm to 800 nm which is then converted into light at lower wavelengths by uv irradiation.Formula:C10H10N4Purity:Min. 97 Area-%Color and Shape:White PowderMolecular weight:186.21 g/mol





