CymitQuimica logo

CAS 18514-84-6

:

1H-CINNOLIN-4-ONE

Description:
1H-Cinnolin-4-one is an organic compound characterized by its bicyclic structure, which includes a cinnoline ring system with a ketone functional group at the 4-position. This compound typically appears as a crystalline solid and is known for its pale yellow to off-white color. It has a molecular formula that reflects its composition of carbon, hydrogen, and nitrogen atoms, contributing to its unique chemical properties. 1H-Cinnolin-4-one exhibits moderate solubility in organic solvents, such as ethanol and dimethyl sulfoxide, but is generally less soluble in water. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities, which may include antimicrobial and anti-inflammatory properties. Its reactivity can be attributed to the presence of the carbonyl group, making it a suitable candidate for further chemical modifications. Safety data indicates that, like many organic compounds, it should be handled with care, following appropriate safety protocols to minimize exposure.
Formula:C8H6N2O
InChI:InChI=1/C8H6N2O/c11-8-5-9-10-7-4-2-1-3-6(7)8/h1-5H,(H,10,11)
InChI key:UFMBERDMCRCVSM-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)c(cnn2)O
Synonyms:
  • [1,8]Naphthyridin-4-Ol
  • cinnolin-4(1H)-one
Found 4 products.