CymitQuimica logo

CAS 185747-16-4

:

Carbamic acid, (2-thiazolylmethyl)-, 1,1-dimethylethyl ester

Description:
Carbamic acid, (2-thiazolylmethyl)-, 1,1-dimethylethyl ester, identified by CAS number 185747-16-4, is an organic compound characterized by its carbamate functional group, which is derived from carbamic acid. This compound features a thiazole ring, contributing to its heterocyclic nature, and a tert-butyl ester group, which enhances its lipophilicity and stability. The presence of the thiazole moiety may impart biological activity, making it of interest in pharmaceutical applications. Typically, carbamates exhibit properties such as moderate solubility in organic solvents and potential reactivity with nucleophiles due to the electrophilic carbonyl carbon. The compound may also display specific interactions with biological targets, which can be influenced by the steric and electronic effects of the substituents on the thiazole and the tert-butyl group. Overall, this compound's unique structure suggests potential utility in various chemical and biological contexts, warranting further investigation into its properties and applications.
Formula:C9H14N2O2S
InChI:InChI=1S/C9H14N2O2S/c1-9(2,3)13-8(12)11-6-7-10-4-5-14-7/h4-5H,6H2,1-3H3,(H,11,12)
InChI key:LPVMUQICXQOGRE-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NCC1=NC=CS1
Found 2 products.