CAS 18583-60-3
:Borate(1-), hydrotris(1H-pyrazolato-κN1)-, potassium (1:1), (T-4)-
Description:
Borate(1-), hydrotris(1H-pyrazolato-κN1)-, potassium (1:1), (T-4)-, with the CAS number 18583-60-3, is a coordination compound featuring a borate anion and a hydrotris(pyrazolato) ligand coordinated to a potassium cation. This compound typically exhibits a complex structure characterized by the presence of pyrazole rings, which contribute to its stability and reactivity. The hydrotris(pyrazolato) ligand is known for its ability to form stable complexes with metal ions, enhancing the compound's potential applications in catalysis and materials science. The potassium ion serves to balance the negative charge of the borate, making the compound neutral overall. In terms of solubility, such coordination compounds often display varying degrees of solubility in polar solvents, influenced by the nature of the ligands and the metal center. The unique properties of this compound may also be leveraged in various fields, including medicinal chemistry and inorganic synthesis, due to its distinctive coordination environment and electronic characteristics.
Formula:C9H10BN6·K
InChI:InChI=1S/C9H10BN6.K/c1-4-11-14(7-1)10(15-8-2-5-12-15)16-9-3-6-13-16;/h1-10H;/q-1;+1
InChI key:InChIKey=IBNGZWIUPDMZMG-UHFFFAOYSA-N
SMILES:[B+3]([H-])([N-]1C=CC=N1)([N-]2C=CC=N2)[N-]3C=CC=N3.[K+]
Synonyms:- 1H-Pyrazole, boron complex
- Borate(1-), hydrotris(1H-pyrazolato-N<sup>1</sup>)-, potassium, (T-4)-
- Borate(1-), hydrotris(1H-pyrazolato-κN<sup>1</sup>)-, potassium (1:1), (T-4)-
- Borate(1-), hydrotris(1H-pyrazolato-κN<sup>1</sup>)-, potassium, (T-4)-
- Borate(1-), hydrotris(pyrazolato)-, potassium
- Potassium Hydrotris(1-Pyrazolato)-Borate, Hydrate
- Potassium Hydrotris(1-Pyrazolyl)Borate
- Potassium Hydrotris(1-Pyrazolyl)Borate Hydrate
- Potassium hydridotris(1-pyrazolyl)borate
- Potassium hydrotripyrazolylborate
- Potassium hydrotris (pyrazol-1-yl)borate hydrate, 98%
- Potassium hydrotris(1-pyrazolyl)borate(1-)
- Potassium hydrotris(1H-pyrazol-1-yl)borate
- Potassium hydrotris(pyrazol-1-yl)borate
- Potassium hydrotris(pyrazolato)borate
- Potassium hydrotris(pyrazolato)borate(1-)
- Potassium hydrotris(pyrazolyl)borate
- Potassium hydrotris(pyrazolyl)borate(1-)
- Potassium tripyrazolylborate
- Potassium tris(1-pyrazolyl)borate
- Potassium tris(1-pyrazolyl)hydroborate
- Potassium trispyrazolylborate
- Potassiumhydrotris(pyrazol-1-yl)boratehydrate,98%
- potassium hydrido(tri-1H-pyrazol-1-yl)borate(1-)
- Borate(1-), hydrotris(1H-pyrazolato-N1)-, potassium, (T-4)-
- Borate(1-), hydrotris(1H-pyrazolato-κN1)-, potassium (1:1), (T-4)-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Potassium Tris(1-pyrazolyl)borohydride
CAS:Formula:C9H10BKN6Purity:>97.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:252.13Potassium Tris(1-pyrazolyl)borohydride
CAS:Potassium Tris(1-pyrazolyl)borohydrideFormula:C9H10BKN6Purity:98%Color and Shape:Solid-CrystalMolecular weight:252.13Potassium Tris(1-pyrazolyl)borohydride
CAS:Formula:C9H10BKN6Purity:98%Color and Shape:SolidMolecular weight:252.1252Potassium hydrotris(pyrazol-1-yl)borate hydrate, 98%
CAS:Potassium hydrotris(pyrazol-1-yl)borate hydrate, 98%
Formula:C9H10BN6K·XH2OPurity:98%Color and Shape:white pwdr.Molecular weight:252.13Potassiumtris(1-pyrazolyl)borohydride
CAS:Potassiumtris(1-pyrazolyl)borohydrideFormula:C9H10BKN6Purity:98%Molecular weight:252.13




