CAS 1860-58-8
:(3-BENZYLOXY-PHENYL)-ACETIC ACID
Description:
(3-Benzyloxy-phenyl)-acetic acid, with the CAS number 1860-58-8, is an organic compound characterized by its aromatic structure and the presence of both a carboxylic acid and a benzyloxy group. This compound features a phenyl ring substituted at the 3-position with a benzyloxy group, which enhances its lipophilicity and may influence its biological activity. The carboxylic acid functional group contributes to its acidity and potential reactivity, allowing it to participate in various chemical reactions, such as esterification or amidation. The presence of the benzyloxy moiety can also affect the compound's solubility and interaction with biological targets. Typically, compounds like this may exhibit pharmacological properties, making them of interest in medicinal chemistry. Its synthesis often involves standard organic reactions, and it can be characterized using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity. Overall, (3-Benzyloxy-phenyl)-acetic acid is a versatile compound with potential applications in research and pharmaceuticals.
Formula:C15H14O3
InChI:InChI=1/C15H14O3/c16-15(17)10-13-7-4-8-14(9-13)18-11-12-5-2-1-3-6-12/h1-9H,10-11H2,(H,16,17)
SMILES:c1ccc(cc1)COc1cccc(c1)CC(=O)O
Synonyms:- Rarechem Al Bo 1519
- 3-Benzyloxyphenylacetic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Benzyloxyphenylacetic Acid
CAS:Formula:C15H14O3Purity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:242.272-(3-(Benzyloxy)phenyl)acetic acid
CAS:Formula:C15H14O3Purity:98%Color and Shape:SolidMolecular weight:242.26993-(Benzyloxy)phenylacetic acid
CAS:3-(Benzyloxy)phenylacetic acidFormula:C15H14O3Purity:98%Molecular weight:242.269862-(3-(Benzyloxy)phenyl)acetic acid
CAS:Formula:C15H14O3Purity:98%Color and Shape:SolidMolecular weight:242.274(3-Benzyloxyphenyl)acetic acid
CAS:(3-Benzyloxyphenyl)acetic acid is a synthetic compound that is used as a precursor in the synthesis of benzodiazepines. It has been shown to have pharmacological properties and can be used in the treatment of blood pressure. (3-Benzyloxyphenyl)acetic acid also has a profile that is hydroxyl, labile, and easily converted to other compounds. It undergoes photolytic degradation, which results in its elimination from the body after only a few hours. The drug is chiral, which means it can exist in two forms with different chemical structures. Both forms are active but with different pharmacokinetic properties. Optimization of this molecule may lead to an increase in one or both of these properties. (3-Benzyloxyphenyl)acetic acid also has nerve depressant effects due to its interaction with GABA receptors and may also have an effect on the central nervous system. END>Formula:C15H14O3Purity:Min. 95%Color and Shape:PowderMolecular weight:242.27 g/mol




