CymitQuimica logo

CAS 186088-50-6

:

1-Butylpyridinium hexafluorophosphate

Description:
1-Butylpyridinium hexafluorophosphate is an ionic liquid characterized by its unique combination of a pyridinium cation and a hexafluorophosphate anion. The cation, 1-butylpyridinium, consists of a pyridine ring substituted with a butyl group, which contributes to its solubility and stability. This compound is typically colorless to pale yellow and exhibits low volatility, making it an attractive alternative to traditional organic solvents. It has a relatively high thermal stability and is non-flammable, which enhances its safety profile for various applications. The hexafluorophosphate anion is known for its strong electronegativity and ability to stabilize the cation, contributing to the ionic liquid's overall properties. 1-Butylpyridinium hexafluorophosphate is often utilized in electrochemistry, as a solvent for chemical reactions, and in various applications in materials science due to its favorable ionic conductivity and ability to dissolve a wide range of substances. Its unique characteristics make it a subject of interest in both academic and industrial research.
Formula:C9H14N.PF6
InChI:InChI=1/C9H14N.F6P/c1-2-3-7-10-8-5-4-6-9-10;1-7(2,3,4,5)6/h4-6,8-9H,2-3,7H2,1H3;/q+1;-1
InChI key:CTMFVASPBJWPFC-UHFFFAOYSA-N
SMILES:CCCC[N+]1=CC=CC=C1.F[P-](F)(F)(F)(F)F
Synonyms:
  • N-butylpyridinium hexafluorophosphate
Found 5 products.