CAS 1861-01-4

ETHYL-ALPHA,ALPHA-D2-BENZENE

Description:

Ethyl-alpha,alpha-D2-benzene, with the CAS number 1861-01-4, is a deuterated derivative of ethylbenzene, where the ethyl group is substituted with deuterium isotopes at the alpha position. This compound is characterized by its aromatic structure, which consists of a benzene ring bonded to an ethyl group. The presence of deuterium, a stable isotope of hydrogen, enhances its utility in various applications, particularly in nuclear magnetic resonance (NMR) spectroscopy and studies involving isotopic labeling. Ethyl-alpha,alpha-D2-benzene is typically a colorless liquid at room temperature and exhibits properties similar to those of ethylbenzene, including a relatively low boiling point and moderate solubility in organic solvents. Its unique isotopic composition allows for distinct spectral signatures in analytical techniques, making it valuable in research fields such as organic chemistry and pharmacology. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance.

Formula: C₈H₈D₂

InChI: InChI=1S/C8H10/c1-2-8-6-4-3-5-7-8/h3-7H,2H2,1H3/i2D2

InChI key: YNQLUTRBYVCPMQ-CBTSVUPCSA-N

SMILES: [2H]C([2H])(C)C1=CC=CC=C1

Synonyms:

• Ethyl-1,1-D2-Benzene
• Ethyl-1,1-D2-Benzene 97%
• Ethyl-α,α-D2-benzene

Ethyl-α,α-d2-benzene

CAS: 100-41-4, 1861-01-4

Formula: C₆H₅CD₂CH₃

Purity: 98 atom % D

Color and Shape: Colorless Liquid

Molecular weight: 108.0908

Ref: 3U-D1905

Ethyl-Alpha,Alpha-d2-benzene

Controlled Product

CAS: 1861-01-4

Applications Ethyl-alpha,alpha-d2-benzene (CAS# 1861-01-4) is a useful isotopically labeled research compound.

Formula: C₈D₂H₈

Color and Shape: Neat

Molecular weight: 108.1773

Ref: TR-E899761