CymitQuimica logo

CAS 186347-72-8

:

1(2H)-Pyridinecarboxylic acid, 3,6-dihydro-4-phenyl-, 1,1-dimethylethylester

Description:
1(2H)-Pyridinecarboxylic acid, 3,6-dihydro-4-phenyl-, 1,1-dimethylethylester, identified by CAS number 186347-72-8, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid derivative, specifically an ester, where the carboxylic acid is modified by the presence of a tert-butyl group (1,1-dimethylethyl) and a phenyl group. The presence of these substituents contributes to its unique chemical properties, including potential lipophilicity and reactivity. The compound may exhibit moderate solubility in organic solvents and limited solubility in water due to its hydrophobic characteristics. It may also participate in various chemical reactions typical of esters, such as hydrolysis and transesterification. Additionally, the compound's structure suggests potential applications in pharmaceuticals or agrochemicals, where pyridine derivatives are often explored for their biological activity. As with many organic compounds, safety data should be consulted for handling and usage.
Formula:C16H21NO2
InChI:InChI=1S/C16H21NO2/c1-16(2,3)19-15(18)17-11-9-14(10-12-17)13-7-5-4-6-8-13/h4-9H,10-12H2,1-3H3
InChI key:OESDBFQMFCAJFP-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(=CC1)C2=CC=CC=C2
Found 2 products.