CAS 18638-99-8: 3,4,5-Trimethoxybenzylamine
Description:3,4,5-Trimethoxybenzylamine is an organic compound characterized by its benzylamine structure, which features a benzene ring substituted with three methoxy groups at the 3, 4, and 5 positions. This substitution pattern enhances its solubility in organic solvents and may influence its reactivity and biological activity. The presence of the amine group (-NH2) contributes to its basicity and potential for forming hydrogen bonds, making it a candidate for various chemical reactions, including alkylation and acylation. The methoxy groups can also affect the compound's electronic properties, potentially enhancing its ability to act as a ligand in coordination chemistry or as a precursor in organic synthesis. Additionally, 3,4,5-trimethoxybenzylamine may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its CAS number, 18638-99-8, allows for easy identification in chemical databases and literature. Overall, this compound's unique structure and functional groups make it a valuable subject of study in both synthetic and applied chemistry.
Formula:C10H15NO3
InChI:InChI=1S/C10H15NO3/c1-12-8-4-7(6-11)5-9(13-2)10(8)14-3/h4-5H,6,11H2,1-3H3
InChI key:InChIKey=YUPUSBMJCFBHAP-UHFFFAOYSA-N
SMILES:O(C=1C=C(C=C(OC)C1OC)CN)C
- Synonyms:
- (3,4,5-Trimethoxyphenyl)Methanaminium
- (3,4,5-Trimethoxyphenyl)methanamine
- 1-(3,4,5-Trimethoxyphenyl)Methanamine
- 3,4,5-Trimethoxybenzenemethanamine
- 3,4,5-Trimethoxyphenylmethylamine
- 3,4,5-Tris(methyloxy)benzylamine
- Benzenemethanamine, 3,4,5-trimethoxy-
- Benzylamine, 3,4,5-trimethoxy-
- NSC 101336
- 3,4,5-Trimethoxybenzylamine
- See more synonyms
