CymitQuimica logo

CAS 1864015-49-5

:

3-Thiophenamine, 4-bromo-, hydrochloride (1:1)

Description:
3-Thiophenamine, 4-bromo-, hydrochloride (1:1) is a chemical compound characterized by the presence of a thiophene ring and an amine functional group, along with a bromine substituent at the para position relative to the amine. This compound exists as a hydrochloride salt, which enhances its solubility in water and may influence its biological activity. The thiophene moiety contributes to its aromatic properties, while the amine group can participate in hydrogen bonding, making it potentially useful in various chemical reactions and applications. The presence of the bromine atom can also affect the compound's reactivity and stability. Typically, such compounds are of interest in medicinal chemistry and materials science due to their unique electronic properties and potential biological activities. As with many halogenated amines, safety precautions should be taken when handling this substance, as it may pose health risks. Overall, 3-Thiophenamine, 4-bromo-, hydrochloride (1:1) is a versatile compound with potential applications in research and industry.
Formula:C4H4BrNS·ClH
InChI:InChI=1S/C4H4BrNS.ClH/c5-3-1-7-2-4(3)6;/h1-2H,6H2;1H
InChI key:InChIKey=WPEBCMRYBQKBBF-UHFFFAOYSA-N
SMILES:BrC=1C(N)=CSC1.Cl
Synonyms:
  • 4-Bromothiophen-3-amine hydrochloride
  • 3-Thiophenamine, 4-bromo-, hydrochloride (1:1)
  • 4-Bromo-3-aminothiophene hydrochloride
Found 4 products.