CymitQuimica logo

CAS 186432-20-2

:

5,7-Difluoroindole-2-carboxylic acid

Description:
5,7-Difluoroindole-2-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of two fluorine atoms at the 5 and 7 positions of the indole ring significantly influences its chemical properties, including its reactivity and polarity. The carboxylic acid functional group at the 2 position contributes to its acidity and solubility in polar solvents. This compound is of interest in medicinal chemistry and material science due to its potential biological activity and utility in synthesizing various derivatives. Its fluorinated nature may enhance metabolic stability and bioavailability in pharmaceutical applications. Additionally, 5,7-Difluoroindole-2-carboxylic acid can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a versatile building block in organic synthesis. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during its use.
Formula:C9H5F2NO2
InChI:InChI=1S/C9H5F2NO2/c10-5-1-4-2-7(9(13)14)12-8(4)6(11)3-5/h1-3,12H,(H,13,14)
InChI key:WVZUEYDXSLBMEK-UHFFFAOYSA-N
SMILES:C1=C2C=C(NC2=C(C=C1F)F)C(=O)O
Synonyms:
  • 5,7-Difluoro-1H-Indole-2-Carboxylic Acid
  • 5,7-Difluoro-2-Indolecarboxylic Acid
Found 4 products.