CymitQuimica logo

CAS 18648-66-3

:

2-(4-bromophenyl)-1,1-diphenylethylene

Description:
2-(4-Bromophenyl)-1,1-diphenylethylene, with the CAS number 18648-66-3, is an organic compound characterized by its structure, which features a diphenylethylene core substituted with a bromophenyl group. This compound typically exhibits properties associated with aromatic compounds, such as stability and relatively low reactivity under standard conditions. It is likely to be a solid at room temperature, with a high melting point due to the presence of multiple aromatic rings that enhance intermolecular interactions. The bromine substituent can influence its electronic properties, potentially making it a candidate for applications in organic electronics or as a building block in organic synthesis. Additionally, the compound may exhibit fluorescence or other photophysical properties, making it of interest in materials science. Its solubility is generally limited in polar solvents but may be more soluble in nonpolar organic solvents. Safety data should be consulted for handling, as brominated compounds can pose health risks.
Formula:C20H15Br
InChI:InChI=1/C20H15Br/c21-19-13-11-16(12-14-19)15-20(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-15H
InChI key:HUCFDUOIMSRYAA-UHFFFAOYSA-N
SMILES:c1ccc(cc1)C(=Cc1ccc(cc1)Br)c1ccccc1
Synonyms:
  • 1-Bromo-4-(2,2-Diphenylethenyl)Benzene
  • 2-(4-Bromophenyl)-1,1-diphenylethene
Found 4 products.