CymitQuimica logo

CAS 18655-47-5

:

Triformylmethane

Description:
Triformylmethane, with the CAS number 18655-47-5, is an organic compound characterized by its unique structure, which features three formyl (–CHO) groups attached to a central carbon atom. This compound is typically a colorless to pale yellow solid at room temperature and is known for its strong aldehyde odor. Triformylmethane is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. It is primarily used in organic synthesis and as an intermediate in the production of various chemical compounds. The presence of multiple formyl groups makes it a versatile building block in the synthesis of complex organic molecules, including pharmaceuticals and agrochemicals. Additionally, triformylmethane can participate in various chemical reactions, such as condensation and polymerization, making it valuable in materials science. However, due to its reactivity, it should be handled with care, as it may pose health risks if inhaled or ingested.
Formula:C4H4O3
InChI:InChI=1/C4H4O3/c5-1-4(2-6)3-7/h1-4H
InChI key:WRWNFZAKUHZONV-UHFFFAOYSA-N
SMILES:C(=O)C(C=O)C=O
Synonyms:
  • 2-Formyl-Malonaldehyde
  • Methanetricarbaldehyde
Found 4 products.