
CAS 186895-85-2
:4-Amino-1-tert-butyl-3-(3-benzyl)pyrazolo[3,4-d]pyrimidine
Description:
4-Amino-1-tert-butyl-3-(3-benzyl)pyrazolo[3,4-d]pyrimidine is a heterocyclic organic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound features an amino group at the 4-position and a tert-butyl group at the 1-position, contributing to its lipophilicity and potential biological activity. The presence of a benzyl substituent at the 3-position enhances its structural complexity and may influence its interaction with biological targets. Typically, compounds of this class are investigated for their pharmacological properties, including potential anti-inflammatory or anti-cancer activities. The molecular structure allows for various interactions, such as hydrogen bonding and π-π stacking, which can be crucial for binding to biological macromolecules. Additionally, the compound's solubility and stability can be affected by the substituents on the pyrazolo-pyrimidine core. Overall, 4-Amino-1-tert-butyl-3-(3-benzyl)pyrazolo[3,4-d]pyrimidine represents a significant scaffold in medicinal chemistry, warranting further exploration for therapeutic applications.
Formula:C16H19N5
InChI:InChI=1S/C16H19N5/c1-16(2,3)21-15-13(14(17)18-10-19-15)12(20-21)9-11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3,(H2,17,18,19)
InChI key:DCRVCTFFEZBXCK-UHFFFAOYSA-N
SMILES:CC(C)(C)N1C2=NC=NC(=C2C(=N1)CC3=CC=CC=C3)N
Synonyms:- 1-(1,1-Dimethylethyl)-3-(phenylmethyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine
- 1-B-Pp1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
3-Benzyl-1-(tert-butyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine
CAS:Formula:C16H19N5Color and Shape:SolidMolecular weight:281.35564-Amino-1-tert-butyl-3-benzylpyrazolo[3,4-d]pyrimidine
CAS:Controlled ProductApplications A derivative of 4-aminopyrazolo[3,4-d]pyridine as tyrosine kinase inhibitor.
References Dohmen, R., et al.: Science, 263, 1273 (1994), Davies, S., et al.: Biochem. J., 351, 95 (2000), Gregan, J., et al.: Mol. Biol. Cell., 14, 3876 (2003), Zeidler, M., et al.: Nat. Biotechnol., 22, 871 (2004), Knight, Z., et al.: Cell, 128, 425 (2007),Formula:C16H19N5Color and Shape:NeatMolecular weight:281.36


