CymitQuimica logo

CAS 18708-46-8

:

Benzoic acid, 4-(chlorocarbonyl)- (9CI)

Description:
Benzoic acid, 4-(chlorocarbonyl)-, also known by its CAS number 18708-46-8, is an aromatic carboxylic acid characterized by the presence of a benzoic acid moiety with a chlorocarbonyl substituent at the para position. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as dichloromethane and ether, but has limited solubility in water due to its hydrophobic aromatic structure. The chlorocarbonyl group introduces reactivity, making it a potential intermediate in organic synthesis, particularly in the formation of amides or esters. Its chemical properties include the ability to undergo nucleophilic substitution reactions, and it may also participate in electrophilic aromatic substitution due to the electron-withdrawing nature of the chlorocarbonyl group. Safety considerations should be taken into account, as it may be harmful if inhaled or ingested, and appropriate handling procedures should be followed in laboratory settings. Overall, this compound is of interest in various chemical applications, particularly in the synthesis of more complex organic molecules.
Formula:C8H5ClO3
InChI:InChI=1S/C8H5ClO3/c9-7(10)5-1-3-6(4-2-5)8(11)12/h1-4H,(H,11,12)
InChI key:OYEQKMASMPBQMP-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C(=O)O)C(=O)Cl
Found 4 products.