CymitQuimica logo

CAS 187739-60-2

:

Carboxyamidotriazole orotate

Description:
Carboxyamidotriazole orotate (CAS 187739-60-2) is a chemical compound that belongs to the class of triazole derivatives. It is characterized by its unique structure, which includes a triazole ring and a carboxamide functional group, contributing to its biological activity. This compound is primarily known for its potential pharmacological properties, particularly in the context of cancer research and as an immunomodulator. Carboxyamidotriazole orotate has been studied for its ability to inhibit certain cellular processes, including angiogenesis and tumor growth, making it of interest in therapeutic applications. Additionally, it may exhibit neuroprotective effects and influence calcium signaling pathways. The compound is typically administered in specific formulations, and its solubility and stability can vary based on the conditions. As with many chemical substances, understanding its mechanism of action and potential side effects is crucial for its application in medicine. Overall, carboxyamidotriazole orotate represents a promising area of research in the field of medicinal chemistry.
Formula:C22H16Cl3N7O6
InChI:InChI=1S/C17H12Cl3N5O2.C5H4N2O4/c18-10-3-1-9(2-4-10)15(26)13-11(19)5-8(6-12(13)20)7-25-16(21)14(17(22)27)23-24-25;8-3-1-2(4(9)10)6-5(11)7-3/h1-6H,7,21H2,(H2,22,27);1H,(H,9,10)(H2,6,7,8,11)
InChI key:MNWOBDDXRRBONM-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C(=O)C2=C(C=C(C=C2Cl)CN3C(=C(N=N3)C(=O)N)N)Cl)Cl.C1=C(NC(=O)NC1=O)C(=O)O
Found 3 products.