CymitQuimica logo

CAS 187746-94-7

:

5-chloro-3-sulfo-2-Thiophenecarboxylic acid

Description:
5-Chloro-3-sulfo-2-thiophenecarboxylic acid is an organosulfur compound characterized by the presence of a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features a carboxylic acid functional group and a sulfonic acid group, contributing to its acidic properties and potential for solubility in polar solvents. The chlorine substituent at the 5-position of the thiophene ring introduces electronegative characteristics, which can influence the compound's reactivity and interaction with other molecules. The sulfonic acid group enhances the compound's hydrophilicity, making it more soluble in water compared to non-sulfonated thiophenes. This compound may exhibit biological activity, making it of interest in pharmaceuticals or agrochemicals. Its unique structure allows for various applications, including use as a reagent in organic synthesis or as a potential dye or pigment. Safety and handling precautions should be observed due to the presence of chlorine and sulfonic acid groups, which can pose hazards in concentrated forms.
Formula:C5H3ClO5S2
InChI:InChI=1S/C5H3ClO5S2/c6-3-1-2(13(9,10)11)4(12-3)5(7)8/h1H,(H,7,8)(H,9,10,11)
InChI key:RBQFMYATYGPWNV-UHFFFAOYSA-N
SMILES:C1=C(SC(=C1S(=O)(=O)O)C(=O)O)Cl
Found 5 products.