CAS 188357-34-8
:Ethyl2,3-di-O-benzyl-4,6-O-benzylidene-a-D-thiomannopyranosideS-oxide
Description:
Ethyl 2,3-di-O-benzyl-4,6-O-benzylidene-α-D-thiomannopyranoside S-oxide is a complex organic compound that belongs to the class of glycosides, specifically a thioglycoside derivative. This compound features a thiomannopyranoside structure, which is a sugar derivative where a sulfur atom replaces the oxygen in the glycosidic bond. The presence of multiple benzyl groups indicates that it has significant aromatic character, which can influence its solubility and reactivity. The S-oxide functional group suggests that the compound may exhibit unique oxidative properties, potentially affecting its stability and reactivity in various chemical environments. This compound is likely to be of interest in synthetic organic chemistry and may have applications in the development of glycosylation reactions or as a building block in the synthesis of more complex molecules. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the presence of functional groups within its structure.
Formula:C29H32O6S
InChI:InChI=1/C29H32O6S/c1-2-36(30)29-27(32-19-22-14-8-4-9-15-22)26(31-18-21-12-6-3-7-13-21)25-24(34-29)20-33-28(35-25)23-16-10-5-11-17-23/h3-17,24-29H,2,18-20H2,1H3/t24?,25-,26+,27-,28?,29-,36?/m1/s1
InChI key:HOPJJYXGUGPOFD-BCELFKBGSA-N
SMILES:CCS(=O)[C@@H]1[C@@H]([C@H]([C@H]2C(O1)COC(O2)C3=CC=CC=C3)OCC4=CC=CC=C4)OCC5=CC=CC=C5
Synonyms:- α-D-Mannopyranose, 1-deoxy-1-(ethylsulfinyl)-2,3-bis-O-(phenylmethyl)-4,6-O-[(R)-phenylmethylene]-
- Ethyl 2,3-di-O-benzyl-4,6-O-(R)-benzylidene-1-deoxy-1-thio-α-D-mannopyranoside S-oxide
- Ethyl2,3-di-O-benzyl-4,6-O-benzylidene-a-D-thiomannopyranosideS-oxide
- 1-Deoxy-1-(ethylsulfinyl)-2,3-bis-O-(phenylMethyl)-4,6-O-[(R)-phenylMethylene]-
- Ethyl 2,3-di-O-benzyl-4,6-O-(R)-benzylidene-1-deoxy-1-thio-alpha-D-mannopyranoside S-oxide min. 98%
- Ethyl 2,3-Di-O-benzyl-4,6-O-benzylidene-1-deoxy-1-thio-α-D-mannopyranoside S-Oxide
- 2,3-Di-O-benzyl-4,6-O-(R)-benzylidene-1-deoxy-1-(ethylsulfinyl)-alpha-D-mannopyranoside
- 7,8-Bis(benzyloxy)-6-(ethylsulfinyl)-2-phenylhexahydropyrano[3,2-d][1,3]dioxine
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Ethyl 2,3-di-O-benzyl-4,6-O-(R)-benzylidene-1-deoxy-1-thio-α-D-mannopyranoside S-oxide
CAS:Ethyl 2,3-di-O-benzyl-4,6-O-(R)-benzylidene-1-deoxy-1-thio-α-D-mannopyranoside S-oxideFormula:C29H32O6SPurity:>98%Molecular weight:508.62578α-D-Mannopyranose, 1-deoxy-1-(ethylsulfinyl)-2,3-bis-O-(phenylmethyl)-4,6-O-[(R)-phenylmethylene]-
CAS:Formula:C29H32O6SColor and Shape:SolidMolecular weight:508.6258Ethyl 2,3-Di-O-benzyl-4,6-O-benzylidene-1-deoxy-1-thio-α-D-mannopyranoside S-Oxide
CAS:Molecular weight:508.63Ethyl 2,3-di-O-benzyl-4,6-O-benzylidene-a-D-thiomannopyranoside S-oxide
CAS:Ethyl 2,3-di-O-benzyl-4,6-O-benzylidene-a-D-thiomannopyranoside S-oxide is a glycosylated compound that contains an O-(2,3) Dibenzyl side chain. This product is a white solid and can be used for the synthesis of other compounds. It has been shown to have antibacterial activity against Mycobacterium tuberculosis and may be used as a drug target for tuberculosis treatment. This product is also useful in the synthesis of oligosaccharides and polysaccharides.
Formula:C29H32O6SPurity:Min. 95%Color and Shape:PowderMolecular weight:508.63 g/molEthyl 2,3-Di-O-benzyl-4,6-O-benzylidene-1-deoxy-1-thio-alpha-D-mannopyranoside S-Oxide
CAS:Controlled ProductApplications Used in direct synthesis of β-mannopyranosides by the sulfoxide method.
References Srivastava, V., et al.: Carbohydr. Res., 79, C13 (1980), Liang, R., et al.: Science, 274, 1520 (1996),Formula:C29H32O6SColor and Shape:NeatMolecular weight:508.63





