CAS 1887-02-1
:2,5-Cyclohexadiene-1,4-dione, 2,3,5,6-tetrahydroxy-, sodium salt (1:2)
Description:
2,5-Cyclohexadiene-1,4-dione, 2,3,5,6-tetrahydroxy-, sodium salt (1:2), with CAS number 1887-02-1, is a sodium salt derivative of a polyhydroxy compound. This substance features a cyclohexadiene core with two carbonyl groups and four hydroxyl groups, contributing to its reactivity and solubility in water. The presence of multiple hydroxyl groups enhances its potential for hydrogen bonding, making it a polar compound. As a sodium salt, it is typically more soluble in aqueous solutions compared to its non-salt form. This compound may exhibit antioxidant properties due to its ability to donate electrons, which can be beneficial in various biochemical applications. Additionally, its structure suggests potential applications in organic synthesis and as a reagent in chemical reactions. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any risks associated with its use.
Formula:C6H4O6·2Na
InChI:InChI=1S/C6H4O6.2Na/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h7-8,11-12H;;
InChI key:InChIKey=SKKLCGZRLDOAMH-UHFFFAOYSA-N
SMILES:O=C1C(O)=C(O)C(=O)C(O)=C1O.[Na]
Synonyms:- 2,3,5,6-Tetrahydroxy-1,4-benzoquinone, disodium salt
- 2,5-Cyclohexadiene-1,4-dione, 2,3,5,6-tetrahydroxy-, disodium salt
- 2,5-Cyclohexadiene-1,4-dione, 2,3,5,6-tetrahydroxy-, sodium salt (1:2)
- Dipotassium 4,6-Dihydroxy-2,5-Dioxocyclohexa-3,6-Diene-1,3-Diolate
- Disodium 4,6-Dihydroxy-2,5-Dioxocyclohexa-3,6-Diene-1,3-Diolate
- M 122
- Nci 974
- Nsc 33520
- Sodium, [(dihydroxy-p-benzoquinonylene)dioxy]di-
- Tetrahydroxy-1,4-benzoquinone Disodium Salt
- Tetrahydroxyquinone disodium
- Tetrahydroxyquinone disodium derivative
- Tetrahydroxyquinone, disodium salt
- Tetroquinone disodium derivative
- p-Benzoquinone, 2,3,5,6-tetrahydroxy-, disodium salt
- p-Benzoquinone, 2,3,5,6-tetrahydroxy-, disodium salt (8CI)
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Tetrahydroxy-1,4-benzoquinone Disodium Salt
CAS:Formula:C6H2Na2O6Color and Shape:Dark green to Dark blue to Black powder to crystalMolecular weight:216.06Tetrahydroxy-1,4-Benzoquinone Disodium Salt
CAS:Tetrahydroxy-1,4-Benzoquinone Disodium SaltFormula:C6H2Na2O6Purity:98%Molecular weight:216.062,5-Cyclohexadiene-1,4-dione, 2,3,5,6-tetrahydroxy-, sodium salt (1:2)
CAS:Formula:C6H6Na2O6Purity:95%Color and Shape:SolidMolecular weight:220.0878Tetrahydroxyquinone disodium
CAS:Tetrahydroxyquinone disodium is a bioactive chemical.Formula:C6H2Na2O6Purity:98%Color and Shape:SolidMolecular weight:216.06Tetrahydroxy-1,4-benzoquinone disodium
CAS:Tetrahydroxy-1,4-benzoquinone disodium salt is a reaction product of hydrogen peroxide and an alkali metal. It is a nucleophilic compound with a hydration rate that depends on the concentration of hydrogen peroxide. Tetrahydroxy-1,4-benzoquinone disodium salt reacts with amines to form radical species that can be detected by electron spin resonance spectroscopy. These radicals have been shown to be more reactive than the parent amine and can lead to enhanced reactivity in some cases.Formula:C6H4O6•Na2Color and Shape:PowderMolecular weight:218.07 g/molSodium 4,5-dihydroxy-3,6-dioxocyclohexa-1,4-diene-1,2-bis(olate)
CAS:Formula:C6H2Na2O6Purity:95%Color and Shape:SolidMolecular weight:216.056






