CymitQuimica logo

CAS 188751-56-6

:

1-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]cycloheptanecarboxylic acid

Description:
1-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]cycloheptanecarboxylic acid, commonly referred to as Fmoc-cycloheptanecarboxylic acid, is a chemical compound characterized by its unique structure that includes a cycloheptane ring and an Fmoc (fluorenylmethyloxycarbonyl) protecting group. This compound is primarily used in peptide synthesis as a protecting group for amino acids, allowing for selective reactions during the synthesis process. The Fmoc group is known for its stability under basic conditions and can be removed under mild acidic conditions, making it advantageous in synthetic chemistry. The presence of the cycloheptanecarboxylic acid moiety contributes to the compound's potential for forming various derivatives, which can be useful in medicinal chemistry and drug design. Additionally, the compound's solubility and reactivity can be influenced by the functional groups present, making it a versatile building block in organic synthesis. Overall, its structural features and functional properties make it a valuable compound in the field of organic and medicinal chemistry.
Formula:C23H25NO4
InChI:InChI=1S/C23H25NO4/c25-21(26)23(13-7-1-2-8-14-23)24-22(27)28-15-20-18-11-5-3-9-16(18)17-10-4-6-12-19(17)20/h3-6,9-12,20H,1-2,7-8,13-15H2,(H,24,27)(H,25,26)
InChI key:InChIKey=KTXGWSABCZHTNH-UHFFFAOYSA-N
SMILES:C(OC(NC1(C(O)=O)CCCCCC1)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3
Synonyms:
  • 1-([[(9H-Fluoren-9-yl)methoxy]carbonyl]amino)cycloheptane-1-carboxylic acid
  • 1-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]cycloheptane-1-carboxylic acid
  • 1-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]cycloheptanecarboxylic acid
  • Cycloheptanecarboxylic acid, 1-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-
  • Cycloheptanecarboxylic acid, 1-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]- (9CI)
  • Fmoc-1-amino-cycloheptane carboxylic acid
Found 3 products.