CAS 189278-27-1
:2-bromo-6-(trifluoromethyl)pyridine
Description:
2-Bromo-6-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with a bromine atom at the 2-position and a trifluoromethyl group at the 6-position. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the bromine atom contributes to its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry and agrochemical applications. Additionally, the compound exhibits polar characteristics due to the electronegative fluorine atoms, which can affect its solubility in different solvents. Its unique structure allows for potential applications in the synthesis of pharmaceuticals and other functional materials. Safety precautions should be taken when handling this compound, as it may pose health risks due to its halogenated nature.
Formula:C6H3BrF3N
InChI:InChI=1/C6H3BrF3N/c7-5-3-1-2-4(11-5)6(8,9)10/h1-3H
SMILES:c1cc(C(F)(F)F)nc(c1)Br
Synonyms:- 2-Bromo-6-trifluoromethylpyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Bromo-6-(trifluoromethyl)pyridine
CAS:Formula:C6H3BrF3NPurity:>98.0%(GC)Color and Shape:White to Light yellow powder to lumpMolecular weight:226.002-Bromo-6-(trifluoromethyl)pyridine, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H3BrF3NPurity:97%Color and Shape:White to pale yellow, Crystals or powder or crystalline powder or fused solidMolecular weight:226.02-Bromo-6-(trifluoromethyl)pyridine
CAS:2-Bromo-6-(trifluoromethyl)pyridineFormula:C6H3BrF3NPurity:98%Color and Shape:White-pale yellow SolidMolecular weight:225.99392Pyridine, 2-bromo-6-(trifluoromethyl)-
CAS:Formula:C6H3BrF3NPurity:98%Color and Shape:SolidMolecular weight:225.99392-Bromo-6-trifluoromethylpyridine
CAS:Formula:C6H3BrF3NPurity:97%Color and Shape:SolidMolecular weight:225.996





