CAS 189308-08-5
:(1R,10S)-10-hydroxy-1,6-dimethyl-10-(2-oxopropyl)-1,10-dihydrophenanthro[1,2-b]furan-11(2H)-one
Description:
The chemical substance known as (1R,10S)-10-hydroxy-1,6-dimethyl-10-(2-oxopropyl)-1,10-dihydrophenanthro[1,2-b]furan-11(2H)-one, with the CAS number 189308-08-5, is a complex organic compound characterized by its unique structural features. It contains a phenanthro[1,2-b]furan core, which is a fused polycyclic structure, and exhibits multiple functional groups, including a hydroxyl group and a ketone. The presence of the hydroxyl group suggests potential for hydrogen bonding, which may influence its solubility and reactivity. The dimethyl and oxopropyl substituents contribute to its overall molecular complexity and may affect its biological activity. This compound is of interest in various fields, including medicinal chemistry and natural product synthesis, due to its potential pharmacological properties. Its stereochemistry, indicated by the (1R,10S) configuration, suggests specific spatial arrangements that can significantly impact its interactions with biological targets. Overall, this compound exemplifies the intricate nature of organic molecules and their potential applications in scientific research.
Formula:C21H20O4
InChI:InChI=1/C21H20O4/c1-11-5-4-6-15-14(11)7-8-16-18(15)21(24,9-13(3)22)20(23)17-12(2)10-25-19(16)17/h4-8,12,24H,9-10H2,1-3H3/t12-,21-/m0/s1
SMILES:Cc1cccc2c1ccc1c2[C@@](CC(=O)C)(C(=O)C2=C1OC[C@@H]2C)O
Synonyms:- Phenanthro(1,2-b)furan-11(2H)-one, 1,10-dihydro-10-hydroxy-1,6-dimethyl-10-(2-oxopropyl)-, (1R,10S)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Phenanthro[1,2-b]furan-11(2H)-one, 1,10-dihydro-10-hydroxy-1,6-dimethyl-10-(2-oxopropyl)-, (1R,10S)-
CAS:Formula:C21H20O4Purity:97.0%Molecular weight:336.3811Danshenol A
CAS:Danshenol A has strong aldose reductase (AR) inhibitory activity, has IC50 of 0.10 microM which is comparable to that of epalrestat in clinical use.Formula:C21H20O4Purity:98%Color and Shape:SolidMolecular weight:336.38Danshenol A
CAS:Danshenol A is a natural compound, which is a diterpene quinone derived from the roots of Salvia miltiorrhiza, a perennial plant widely used in traditional Chinese medicine. Its mode of action involves potent antioxidant activity, primarily through scavenging free radicals and inhibiting lipid peroxidation, which contributes to its protective effects against oxidative stress. Research indicates that Danshenol A can modulate various cellular signaling pathways, providing potential therapeutic benefits.
Formula:C21H20O4Purity:Min. 95%Molecular weight:336.4 g/molRef: 3D-PHA30808
Discontinued product


