CymitQuimica logo

CAS 189333-03-7

:

tert-butyl 2,9-diazaspiro[5.5]undecane-2-carboxylate

Description:
Tert-butyl 2,9-diazaspiro[5.5]undecane-2-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which features a combination of nitrogen atoms and a tert-butyl ester functional group. This compound belongs to a class of spiro compounds, which are known for their distinctive ring systems that can influence their chemical reactivity and biological activity. The presence of the diaza (two nitrogen atoms) in the spiro framework contributes to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The tert-butyl group enhances the lipophilicity of the molecule, which can affect its solubility and permeability in biological systems. Additionally, the carboxylate moiety may participate in various chemical reactions, making this compound a versatile building block in organic synthesis. Overall, tert-butyl 2,9-diazaspiro[5.5]undecane-2-carboxylate exhibits interesting structural features that may lead to diverse applications in chemical research and drug development.
Formula:C14H26N2O2
InChI:InChI=1/C14H26N2O2/c1-13(2,3)18-12(17)16-10-4-5-14(11-16)6-8-15-9-7-14/h15H,4-11H2,1-3H3
InChI key:UTFBOGXIVNMTCO-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCCC2(CCNCC2)C1
Synonyms:
  • tert-Butyl-2,9-diazaspiro[5.5]undecan-2-carboxylat
Found 5 products.