CymitQuimica logo

CAS 189333-48-0

:

9-BENZYL-3,9-DIAZA-SPIRO[5.5]UNDECANE-2,4-DIONE

Description:
9-Benzyl-3,9-diaza-spiro[5.5]undecane-2,4-dione is a complex organic compound characterized by its unique spirocyclic structure, which features a bicyclic framework with nitrogen atoms incorporated into the ring system. The presence of the benzyl group contributes to its hydrophobic characteristics, while the diaza functionality introduces basic properties due to the nitrogen atoms. This compound typically exhibits a range of chemical reactivity due to the presence of the diketone functional groups, which can participate in various reactions such as nucleophilic addition and condensation. Its spiro structure may confer interesting stereochemical properties, potentially influencing its biological activity and interactions with other molecules. The compound is of interest in medicinal chemistry and may have applications in drug development, particularly in the design of novel therapeutic agents. As with many organic compounds, its solubility, stability, and reactivity can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C16H20N2O2
InChI:InChI=1/C16H20N2O2/c19-14-10-16(11-15(20)17-14)6-8-18(9-7-16)12-13-4-2-1-3-5-13/h1-5H,6-12H2,(H,17,19,20)
InChI key:MZOUQZZYZKEBKL-UHFFFAOYSA-N
SMILES:c1ccc(cc1)CN1CCC2(CC1)CC(=NC(=O)C2)O
Synonyms:
  • 9-Benzyl-3,9-diazaspiro[5.5]undecan-2,4-dion
Found 4 products.