CAS 18940-21-1
:5,5-Dimethyl-3-(phenylamino)-2-cyclohexen-1-one
Description:
5,5-Dimethyl-3-(phenylamino)-2-cyclohexen-1-one, with the CAS number 18940-21-1, is an organic compound characterized by its unique structural features, including a cyclohexene ring and a phenylamino group. This compound typically exhibits a yellow to orange coloration and is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the dimethyl groups contributes to its steric hindrance, influencing its reactivity and stability. Additionally, the phenylamino substituent can enhance its electronic properties, making it a candidate for further functionalization. The compound's solubility is generally dependent on the solvent used, and it may exhibit moderate to low solubility in polar solvents. Its chemical behavior can be influenced by factors such as pH and temperature, which are important considerations in any synthetic or analytical applications. Overall, 5,5-Dimethyl-3-(phenylamino)-2-cyclohexen-1-one is a versatile compound with notable characteristics that warrant further exploration in various chemical contexts.
Formula:C14H17NO
InChI:InChI=1S/C14H17NO/c1-14(2)9-12(8-13(16)10-14)15-11-6-4-3-5-7-11/h3-8,15H,9-10H2,1-2H3
InChI key:InChIKey=LIHRRTOWVCDHLR-UHFFFAOYSA-N
SMILES:N(C=1CC(C)(C)CC(=O)C1)C2=CC=CC=C2
Synonyms:- 2-Cyclohexen-1-one, 3-anilino-5,5-dimethyl-
- 2-Cyclohexen-1-one, 5,5-dimethyl-3-(phenylamino)-
- 3-Anilino-5,5-dimethyl-2-cyclohexenone
- 3-Anilino-5,5-dimethylcyclohex-2-en-1-one
- 5,5-Dimethyl-3-(phenylamino)-2-cyclohexen-1-one
- 5,5-Dimethyl-3-(phenylamino)cyclohex-2-enone
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3-Anilino-5,5-dimethyl-2-cyclohexen-1-one
CAS:3-Anilino-5,5-dimethyl-2-cyclohexen-1-oneFormula:C14H17NOPurity:≥95%Color and Shape:SolidMolecular weight:215.290885,5-dimethyl-3-(phenylamino)cyclohex-2-en-1-one, 98%
CAS:Formula:C14H17NOPurity:98%Color and Shape:Liquid, No data available.Molecular weight:215.2965,5-dimethyl-3-(phenylamino)cyclohex-2-en-1-one
CAS:5,5-Dimethyl-3-(phenylamino)cyclohex-2-en-1-one is a synthetic compound that belongs to the class of isatins. It is a product of the reaction between methylene chloride and phenyl isothiocyanate with tetrahydrofuran as catalyst. The crystal structure of this compound has been determined in both the acetal and ethyl cyanoacetate forms. 5,5-Dimethyl-3-(phenylamino)cyclohex-2-en-1-one reacts with oxygen at high temperatures to form 5,5'-dimethylisatin. This compound has been shown to have antiinflammatory properties and may be useful in the treatment of inflammatory bowel disease.Purity:Min. 95%Color and Shape:Powder




