CAS 18968-05-3: β-D-Mannopyranose, 1,3,4,6-tetraacetate
Description:β-D-Mannopyranose, 1,3,4,6-tetraacetate is a derivative of mannose, a six-carbon aldose sugar. This compound features a pyranose ring structure, which is a six-membered cyclic form of the sugar. The tetraacetate designation indicates that four hydroxyl groups on the mannose molecule are acetylated, enhancing its stability and solubility in organic solvents. The acetylation process involves the substitution of hydroxyl groups with acetyl groups, which can influence the compound's reactivity and biological interactions. β-D-Mannopyranose itself is known for its role in various biological processes, including its involvement in glycoprotein synthesis and cell recognition. The tetraacetate form is often utilized in synthetic organic chemistry and biochemistry for its protective group characteristics, facilitating further chemical modifications. This compound is typically white to off-white in appearance and is soluble in polar organic solvents. Its applications may extend to research in carbohydrate chemistry and the development of glycosylation reactions.
Formula:C14H20O10
InChI:InChI=1S/C14H20O10/c1-6(15)20-5-10-12(21-7(2)16)13(22-8(3)17)11(19)14(24-10)23-9(4)18/h10-14,19H,5H2,1-4H3/t10-,11+,12-,13-,14-/m1/s1
InChI key:InChIKey=SHBHJRVMGYVXKK-XVIXHAIJSA-N
SMILES:O=C(OCC1OC(OC(=O)C)C(O)C(OC(=O)C)C1OC(=O)C)C
- Synonyms:
- 1,3,4,6-Tetra-O-acetyl-D-mannopyranose
- 1,3,4,6-Tetra-O-acetyl-b-D-mannopyranose
- 1,3,4,6-Tetra-O-acetyl-β-<span class="text-smallcaps">D</span>-mannopyranose
- 1,3,4,6-tetra-O-acetyl-B-D-manno-*pyranose
- Mannopyranose, 1,3,4,6-tetraacetate, β-<span class="text-smallcaps">D</span>-
- Trimethoxy{3-[1,2,2,2-Tetrafluoro-1-(Trifluoromethyl)Ethoxy]Propyl}Silane
- β-<span class="text-smallcaps">D</span>-Mannopyranose, 1,3,4,6-tetraacetate
- β-D-Mannopyranose, 1,3,4,6-tetraacetate
- Mannopyranose, 1,3,4,6-tetraacetate, β-D-
