CAS 18968-05-3
:β-D-Mannopyranose, 1,3,4,6-tetraacetate
Description:
β-D-Mannopyranose, 1,3,4,6-tetraacetate is a derivative of mannose, a six-carbon aldose sugar. This compound features a pyranose ring structure, which is a six-membered cyclic form of the sugar. The tetraacetate designation indicates that four hydroxyl groups on the mannose molecule are acetylated, enhancing its stability and solubility in organic solvents. The acetylation process involves the substitution of hydroxyl groups with acetyl groups, which can influence the compound's reactivity and biological interactions. β-D-Mannopyranose itself is known for its role in various biological processes, including its involvement in glycoprotein synthesis and cell recognition. The tetraacetate form is often utilized in synthetic organic chemistry and biochemistry for its protective group characteristics, facilitating further chemical modifications. This compound is typically white to off-white in appearance and is soluble in polar organic solvents. Its applications may extend to research in carbohydrate chemistry and the development of glycosylation reactions.
Formula:C14H20O10
InChI:InChI=1S/C14H20O10/c1-6(15)20-5-10-12(21-7(2)16)13(22-8(3)17)11(19)14(24-10)23-9(4)18/h10-14,19H,5H2,1-4H3/t10-,11+,12-,13-,14-/m1/s1
InChI key:InChIKey=SHBHJRVMGYVXKK-XVIXHAIJSA-N
SMILES:O(C(C)=O)[C@H]1[C@H](OC(C)=O)[C@H](O)[C@H](OC(C)=O)O[C@@H]1COC(C)=O
Synonyms:- 1,3,4,6-Tetra-O-acetyl-D-mannopyranose
- 1,3,4,6-Tetra-O-acetyl-b-D-mannopyranose
- 1,3,4,6-Tetra-O-acetyl-β-<span class="text-smallcaps">D</span>-mannopyranose
- 1,3,4,6-tetra-O-acetyl-B-D-manno-*pyranose
- Mannopyranose, 1,3,4,6-tetraacetate, β-<span class="text-smallcaps">D</span>-
- Trimethoxy{3-[1,2,2,2-Tetrafluoro-1-(Trifluoromethyl)Ethoxy]Propyl}Silane
- β-<span class="text-smallcaps">D</span>-Mannopyranose, 1,3,4,6-tetraacetate
- β-D-Mannopyranose, 1,3,4,6-tetraacetate
- Mannopyranose, 1,3,4,6-tetraacetate, β-D-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
1,3,4,6-Tetra-O-acetyl-β-D-mannopyranose
CAS:Formula:C14H20O10Purity:>97.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:348.301,3,4,6-Tetra-O-acetyl-β-D-mannopyranose
CAS:1,3,4,6-Tetra-O-acetyl-β-D-mannopyranoseFormula:C14H20O10Color and Shape:SolidMolecular weight:348.30259β-D-Mannopyranose, 1,3,4,6-tetraacetate
CAS:Formula:C14H20O10Purity:97%Color and Shape:SolidMolecular weight:348.30261,3,4,6-Tetra-O-acetyl-b-D-mannopyranose
CAS:Formula:C14H20O10Purity:(HPLC) ≥ 98.0%Color and Shape:White powderMolecular weight:348.31,3,4,6-Tetra-O-acetyl-b-D-mannopyranose
CAS:1,3,4,6-Tetra-O-acetyl-b-D-mannopyranose is a radiopharmaceutical that is used to diagnose and evaluate malignant tumors. It is a diagnostic agent for the detection of cancerous cells in patients with suspected cancer. The molecule emits gamma radiation when it decays. This product has been tested in experimental studies on animals and humans with tumors. There are no known side effects or interactions with other drugs. 1,3,4,6-Tetra-O-acetyl-b-D-mannopyranose can be administered intravenously or orally and can be used to detect cancerous cells in the stomach and small intestine.
Formula:C14H20O10Purity:Min. 95%Color and Shape:White PowderMolecular weight:348.3 g/mol(2S,3S,4R,5R,6R)-6-(Acetoxymethyl)-3-hydroxytetrahydro-2H-pyran-2,4,5-triyl triacetate
CAS:Formula:C14H20O10Purity:95%Color and Shape:Solid, No data available.Molecular weight:348.3041,3,4,6-Tetra-O-acetyl-β-D-mannopyranose
CAS:Controlled ProductFormula:C14H20O10Color and Shape:NeatMolecular weight:348.303








