CymitQuimica logo

CAS 189747-31-7

:

6-chloropyrimido[5,4-d]pyrimidin-4(1H)-one

Description:
6-Chloropyrimido[5,4-d]pyrimidin-4(1H)-one is a heterocyclic compound characterized by its fused pyrimidine rings and the presence of a chlorine atom at the 6-position. This compound features a pyrimidinone structure, which contributes to its potential biological activity. The presence of the chlorine substituent can influence its reactivity and solubility, making it of interest in medicinal chemistry and drug development. The compound is typically synthesized through specific organic reactions that involve the manipulation of pyrimidine derivatives. Its unique structure may exhibit various pharmacological properties, including antimicrobial or anticancer activities, although specific biological data would depend on empirical studies. The compound's molecular weight, solubility, and stability are influenced by its functional groups and overall structure. As with many heterocycles, it may also participate in various chemical reactions, making it a versatile building block in organic synthesis. Safety and handling precautions should be observed due to the presence of chlorine, which can pose health risks.
Formula:C6H3ClN4O
InChI:InChI=1/C6H3ClN4O/c7-6-8-1-3-4(11-6)5(12)10-2-9-3/h1-2H,(H,9,10,12)
InChI key:OBLBJCVARYVWJH-UHFFFAOYSA-N
SMILES:c1c2c(c(=O)[nH]cn2)nc(Cl)n1
Synonyms:
  • 6-Chloropyrimido[5,4-d]pyrimidin-4(3H)-one
  • Pyrimido[5,4-d]pyrimidin-4(3H)-one, 6-chloro-
Found 2 products.