CAS 1903-27-1
:Acetic acid,2-cyclopentylidene-
Description:
Acetic acid, 2-cyclopentylidene- (CAS 1903-27-1) is an organic compound characterized by its functional groups, primarily the carboxylic acid group (-COOH) and a cyclopentylidene moiety. This compound features a cyclopentyl ring, which contributes to its unique structural and physical properties. Typically, acetic acid derivatives exhibit moderate polarity due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. This characteristic influences its solubility in polar solvents, such as water, while also allowing for interactions with non-polar substances. The presence of the cyclopentylidene group may impart distinct steric and electronic effects, potentially affecting the compound's reactivity and stability. Acetic acid derivatives are often utilized in various chemical syntheses, serving as intermediates or solvents in organic reactions. Additionally, they may exhibit biological activity, making them of interest in pharmaceutical and agrochemical research. Overall, the unique structure of acetic acid, 2-cyclopentylidene- contributes to its diverse applications in chemistry and industry.
Formula:C7H10O2
InChI:InChI=1S/C7H10O2/c8-7(9)5-6-3-1-2-4-6/h5H,1-4H2,(H,8,9)
InChI key:CGXLEHPBUZPLAZ-UHFFFAOYSA-N
SMILES:C1CCC(=CC(=O)O)C1
Synonyms:- Aceticacid, cyclopentylidene- (9CI)
- D1,a-Cyclopentaneacetic acid(6CI,7CI)
- Cyclopentylideneacetic acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Cyclopentylideneacetic acid
CAS:2-Cyclopentylideneacetic acidFormula:C7H10O2Purity:98%Molecular weight:126.153092-Cyclopentylideneacetic acid
CAS:2-Cyclopentylideneacetic acid is a growth factor that is structurally similar to epidermal growth factor (EGF) and has been shown to have an inhibitory effect on the EGF receptor. It is used in the manufacture of pharmaceuticals, such as antidiabetic agents, and cosmetics. 2-Cyclopentylideneacetic acid is also used as a synthetic intermediate in the manufacture of other drugs, such as peptide hormones. The two possible tautomers of 2-cyclopentylideneacetic acid are alpha-cyclohexenylacetic acid and beta-cyclohexenylacetic acid. The most stable form of these tautomers is alpha-cyclohexenylacetic acid. 2-Cyclopentylideneacetic acid can be used in the synthesis of epinephrine, norepinephrine, and dopamine.
2-cyclopentylideneacFormula:C7H10O2Purity:Min. 95%Molecular weight:126.15 g/mol




