CAS 19037-72-0

4,4-Dimethylcyclopentene

Description:

4,4-Dimethylcyclopentene is a cyclic hydrocarbon characterized by its unique structure, which includes a cyclopentene ring with two methyl groups attached to the same carbon atom, specifically at the 4-position. This compound is a colorless liquid at room temperature and is known for its distinctive odor. It is classified as an alkene due to the presence of a carbon-carbon double bond within the cyclopentene ring, which contributes to its reactivity, particularly in addition reactions. The presence of the methyl groups influences its physical properties, such as boiling point and solubility, making it less polar than many other organic compounds. 4,4-Dimethylcyclopentene is used in organic synthesis and may serve as an intermediate in the production of various chemicals. Its stability and reactivity can be affected by factors such as temperature and the presence of catalysts. As with many organic compounds, proper handling and safety precautions are essential due to potential flammability and health hazards associated with exposure.

Formula: C₇H₁₂

InChI: InChI=1S/C7H12/c1-7(2)5-3-4-6-7/h3-4H,5-6H2,1-2H3

InChI key: InChIKey=LKXAUCPURVBMRN-UHFFFAOYSA-N

SMILES: CC1(C)CC=CC1

Synonyms:

• Cyclopentene, 4,4-dimethyl-
• 4,4-Dimethylcyclopentene

Cyclopentene, 4,4-dimethyl-

CAS: 19037-72-0

Formula: C₇H₁₂

Molecular weight: 96.1702

Ref: IN-DA002EIA