CymitQuimica logo

CAS 1906-95-2

:

Bromophentylmalonicaciddiethylester

Description:
Bromophentylmalonic acid diethyl ester, identified by its CAS number 1906-95-2, is an organic compound characterized by its structure, which includes a bromophenyl group and two ethyl ester functionalities attached to a malonic acid backbone. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific formulation. It is known for its reactivity, particularly in organic synthesis, where it can participate in various chemical reactions such as esterification and nucleophilic substitution. The presence of the bromine atom enhances its electrophilic character, making it useful in the synthesis of more complex organic molecules. Additionally, the diethyl ester groups contribute to its solubility in organic solvents, facilitating its use in laboratory settings. Safety considerations should be taken into account, as brominated compounds can pose health risks, and appropriate handling and disposal procedures should be followed. Overall, bromophentylmalonic acid diethyl ester serves as a valuable intermediate in organic chemistry and pharmaceutical applications.
Formula:C12H21BrO4
InChI:InChI=1/C12H21BrO4/c1-3-16-11(14)10(12(15)17-4-2)8-6-5-7-9-13/h10H,3-9H2,1-2H3
InChI key:JZCAZGWJCVMTTQ-UHFFFAOYSA-N
SMILES:CCOC(=O)C(CCCCCBr)C(=O)OCC
Synonyms:
  • (5-Bromophentyl)malonic acdi diethyl ester
  • Diethyl (5-Bromopentyl)Propanedioate
Found 7 products.