CAS 190601-71-9
:4-Thiazolecarboxylicacid,4,5-dihydro-2-methyl-,(S)-(9CI)
Description:
4-Thiazolecarboxylic acid, 4,5-dihydro-2-methyl-, (S)-(9CI) is a chemical compound characterized by its thiazole ring structure, which is a five-membered heterocyclic ring containing both sulfur and nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the methyl group at the 2-position of the thiazole ring influences its reactivity and solubility. As a chiral molecule, it exists in two enantiomeric forms, with the (S) configuration being specified in its name. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its CAS number, 190601-71-9, allows for easy identification and reference in chemical databases. In terms of physical properties, it is typically a solid at room temperature, and its solubility can vary depending on the solvent used. Overall, 4-Thiazolecarboxylic acid, 4,5-dihydro-2-methyl-, (S)-(9CI) is a compound of interest in both synthetic and medicinal chemistry due to its unique structural features and potential applications.
Formula:C5H7NO2S
InChI:InChI=1S/C5H7NO2S/c1-3-6-4(2-9-3)5(7)8/h4H,2H2,1H3,(H,7,8)/t4-/m1/s1
InChI key:AYLFNWRGEZKWFP-SCSAIBSYSA-N
SMILES:CC1=N[C@H](CS1)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(4S)-2-methyl-4,5-dihydro-1,3-thiazole-4-carboxylic acid
CAS:Formula:C5H7NO2SMolecular weight:145.1796

