CymitQuimica logo

CAS 19064-73-4

:

1(2H)-Phthalazinone, 4-bromo-

Description:
1(2H)-Phthalazinone, 4-bromo- is an organic compound characterized by its phthalazinone core structure, which features a fused bicyclic system containing a nitrogen atom. The presence of a bromine substituent at the 4-position of the phthalazinone ring significantly influences its chemical properties, including reactivity and solubility. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents such as ethanol and dimethyl sulfoxide, while being less soluble in water. It is often utilized in synthetic organic chemistry as an intermediate for the preparation of various pharmaceuticals and agrochemicals. The compound may also exhibit biological activity, making it of interest in medicinal chemistry research. Its molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. As with many brominated compounds, it is important to handle 1(2H)-Phthalazinone, 4-bromo- with care due to potential toxicity and environmental considerations.
Formula:C8H5BrN2O
InChI:InChI=1S/C8H5BrN2O/c9-7-5-3-1-2-4-6(5)8(12)11-10-7/h1-4H,(H,11,12)
InChI key:DHXVJJHOVGTNDK-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C(=O)NN=C2Br
Found 6 products.