CymitQuimica logo

CAS 190851-19-5

:

Carbamic acid, (4-amino-2-methoxyphenyl)-, 1,1-dimethylethyl ester

Description:
Carbamic acid, (4-amino-2-methoxyphenyl)-, 1,1-dimethylethyl ester, with CAS number 190851-19-5, is an organic compound characterized by its carbamate functional group. This substance features a methoxy group and an amino group attached to a phenyl ring, contributing to its potential biological activity. The presence of the tert-butyl ester group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. Typically, compounds of this nature are studied for their pharmacological properties, including potential applications in medicinal chemistry. The molecular structure suggests that it may participate in hydrogen bonding due to the amino group, which can affect its reactivity and interaction with other molecules. Additionally, the stability of the carbamate linkage can be influenced by environmental factors such as pH and temperature. Overall, this compound's unique structural features make it a subject of interest in various fields, including drug development and chemical synthesis.
Formula:C12H18N2O3
InChI:InChI=1S/C12H18N2O3/c1-12(2,3)17-11(15)14-9-6-5-8(13)7-10(9)16-4/h5-7H,13H2,1-4H3,(H,14,15)
InChI key:YUSDXMQVJPPUTH-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NC1=C(C=C(C=C1)N)OC
Found 4 products.