CymitQuimica logo

CAS 190900-21-1

:

1-N-Boc-5-oxo-1,4-diazepane

Description:
1-N-Boc-5-oxo-1,4-diazepane is a chemical compound characterized by its bicyclic structure, which includes a diazepane ring. The "N-Boc" designation indicates the presence of a tert-butyloxycarbonyl (Boc) protecting group on the nitrogen atom, commonly used in organic synthesis to protect amines. The "5-oxo" part of the name signifies that there is a carbonyl group (C=O) at the fifth position of the diazepane ring, contributing to its reactivity and potential applications in synthesis. This compound is typically utilized in medicinal chemistry and organic synthesis, particularly in the development of pharmaceuticals due to its ability to serve as a building block for more complex molecules. Its properties, such as solubility and stability, can vary depending on the solvent and conditions used. As with many nitrogen-containing heterocycles, it may exhibit interesting biological activities, making it a subject of interest in drug discovery and development. Safety and handling precautions should be observed, as with all chemical substances.
Formula:C10H18N2O3
InChI:InChI=1/C10H18N2O3/c1-10(2,3)15-9(14)12-6-4-8(13)11-5-7-12/h4-7H2,1-3H3,(H,11,13)
InChI key:GLJYPTWEXBUATJ-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(=NCC1)O
Synonyms:
  • Tert-Butyl 5-Oxo-1,4-Diazepane-1-Carboxylate
Found 4 products.