CymitQuimica logo

CAS 1910-41-4

:

FADH2

Description:
FADH2, or flavin adenine dinucleotide in its reduced form, is a crucial coenzyme involved in various biological redox reactions. It plays a significant role in cellular respiration, particularly in the electron transport chain, where it acts as an electron carrier. FADH2 is derived from riboflavin (vitamin B2) and is essential for the function of several flavoproteins, which are enzymes that facilitate oxidation-reduction reactions. The molecule consists of a flavin moiety and an adenine nucleotide, allowing it to participate in electron transfer processes. FADH2 is characterized by its ability to donate electrons and protons, contributing to the generation of ATP through oxidative phosphorylation. Its oxidation back to FAD (flavin adenine dinucleotide) occurs during metabolic processes, releasing energy that is harnessed by the cell. Additionally, FADH2 is sensitive to light and can be affected by environmental conditions, which can influence its stability and reactivity. Overall, FADH2 is vital for energy metabolism and the proper functioning of various biochemical pathways in living organisms.
Formula:C27H35N9O15P2
InChI:InChI=1S/C27H35N9O15P2/c1-10-3-12-13(4-11(10)2)35(24-18(32-12)25(42)34-27(43)33-24)5-14(37)19(39)15(38)6-48-52(44,45)51-53(46,47)49-7-16-20(40)21(41)26(50-16)36-9-31-17-22(28)29-8-30-23(17)36/h3-4,8-9,14-16,19-21,26,32,37-41H,5-7H2,1-2H3,(H,44,45)(H,46,47)(H2,28,29,30)(H2,33,34,42,43)/t14-,15+,16+,19-,20+,21+,26+/m0/s1
InChI key:InChIKey=YPZRHBJKEMOYQH-UYBVJOGSSA-N
SMILES:C([C@@H]([C@@H]([C@@H](COP(OP(OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N2C=3C(N=C2)=C(N)N=CN3)(=O)O)(=O)O)O)O)O)N4C5=C(NC=6C4=CC(C)=C(C)C6)C(=O)NC(=O)N5
Synonyms:
  • Adenosine pyrophosphate, 5′→5′-ester with 5,10-dihydro-7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)alloxazine
  • Riboflavin 5′-(trihydrogen diphosphate), 1,5-dihydro-, P′→5′-ester with adenosine
  • Benzo[g]pteridine, riboflavin 5′-(trihydrogen diphosphate) deriv.
  • FADH
  • Adenosine 5′-(trihydrogen pyrophosphate), 5′→5′-ester with 5,10-dihydro-7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)alloxazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.