CAS 191165-13-6
:4-Bromo-2-(Trifluoromethyl)Benzonitrile
Description:
4-Bromo-2-(trifluoromethyl)benzonitrile is an organic compound characterized by its aromatic structure, which includes a bromine atom and a trifluoromethyl group attached to a benzene ring that also contains a nitrile functional group. The presence of the bromine atom contributes to its reactivity and potential applications in various chemical reactions, while the trifluoromethyl group enhances its lipophilicity and can influence its biological activity. The nitrile group (-C≡N) is known for its ability to participate in nucleophilic addition reactions and can serve as a versatile functional group in synthetic chemistry. This compound is typically used in research and development, particularly in the fields of pharmaceuticals and agrochemicals, due to its unique electronic properties and potential as an intermediate in the synthesis of more complex molecules. Its physical properties, such as melting point, boiling point, and solubility, are influenced by the presence of the halogen and the nitrile group, making it an interesting subject for further study in organic synthesis and material science.
Formula:C8H3BrF3N
InChI:InChI=1/C8H3BrF3N/c9-6-2-1-5(4-13)7(3-6)8(10,11)12/h1-3H
SMILES:c1cc(cc(c1C#N)C(F)(F)F)Br
Synonyms:- 3-Bromo-6-cyanobenzotrifluoride
- 5-Bromo-2-cyanobenzotrifluoride
- 4-Bromo-2-trifluoromethylbenzonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzonitrile, 4-bromo-2-(trifluoromethyl)-
CAS:Formula:C8H3BrF3NPurity:97%Color and Shape:SolidMolecular weight:250.01534-Bromo-2-(trifluoromethyl)benzonitrile
CAS:Formula:C8H3BrF3NPurity:>98.0%(GC)Color and Shape:White to Almost white powder to lumpMolecular weight:250.024-Bromo-2-(trifluoromethyl)benzonitrile
CAS:4-Bromo-2-(trifluoromethyl)benzonitrileFormula:C8H3BrF3NPurity:98%Color and Shape:Solid-PowderMolecular weight:250.015324-Bromo-2-(trifluoromethyl)benzonitrile
CAS:4-Bromo-2-(trifluoromethyl)benzonitrile is an important reagent for the synthesis of heterocycles and natural products. It can be used as a building block in organic synthesis and as a reaction component to synthesize pharmaceuticals, agrochemicals, pesticides, and other chemicals. 4-Bromo-2-(trifluoromethyl)benzonitrile is also used as a research chemical.Formula:C8H3BrF3NPurity:Min. 95%Color and Shape:PowderMolecular weight:250.02 g/mol4-Bromo-2-(trifluoromethyl)benzonitrile
CAS:Controlled ProductApplications 4-Bromo-2-(trifluoromethyl)benzonitrile is an intermediate for the synthesis of 4-Bromo-2-(trifluoromethyl)phenylacetic Acid (B688526), which is a useful intermediate for organic synthesis and other chemical processes.
Formula:C8H3BrF3NColor and Shape:NeatMolecular weight:250.024-Bromo-2-(trifluoromethyl)benzonitrile
CAS:Formula:C8H3BrF3NPurity:97%Color and Shape:SolidMolecular weight:250.018





