CAS 1912-42-1
:1H-pyrrolo(2,3-b)pyridine-3-acetic acid
Description:
1H-pyrrolo(2,3-b)pyridine-3-acetic acid, with the CAS number 1912-42-1, is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both pyrrole and pyridine rings. This compound features an acetic acid functional group, which contributes to its acidic properties. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in medicinal chemistry and pharmacology, as it may possess biological activity, potentially influencing various biochemical pathways. Its structural features allow for interactions with biological targets, making it a candidate for further research in drug development. Additionally, the presence of nitrogen atoms in the rings can affect its electronic properties and reactivity, which are important for its potential applications. Overall, 1H-pyrrolo(2,3-b)pyridine-3-acetic acid is a compound of interest due to its structural complexity and potential therapeutic implications.
Formula:C9H8N2O2
InChI:InChI=1/C9H8N2O2/c12-8(13)4-6-5-11-9-7(6)2-1-3-10-9/h1-3,5H,4H2,(H,10,11)(H,12,13)
InChI key:InChIKey=NQHGQOVKJGGLKE-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1C=2C(NC1)=NC=CC2
Synonyms:- (1H-Pyrrolo[2,3-b]pyridin-3-yl)acetic acid
- 1H-Pyrrolo[2,3-b]pyridin-3-ylacetic acid
- 2-(1H-Pyrrolo[2,3-b]pyridin-3-yl)aceticacid
- 2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetic acid
- 7-Azaindole-3-acetic acid
- 1H-Pyrrolo[2,3-b]pyridine-3-acetic acid
- 1H-pyrrolo[2,3-b]pyridine-3-acetic acid
- 1H-pyrrolo(2,3-b)pyridine-3-acetic acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-(1h-pyrrolo[2,3-b]pyridin-3-yl)acetic acid
CAS:Formula:C9H8N2O2Purity:97%Color and Shape:SolidMolecular weight:176.17202-(1H-Pyrrolo[2,3-b]pyridin-3-yl)acetic acid
CAS:2-(1H-Pyrrolo[2,3-b]pyridin-3-yl)acetic acidFormula:C9H8N2O2Purity:98%Molecular weight:176.172022-(1H-Pyrrolo[2,3-b]pyridin-3-yl)acetic acid
CAS:2-(1H-Pyrrolo[2,3-b]pyridin-3-yl)acetic acidFormula:C9H8N2O2Purity:98%Molecular weight:176.172-(1H-Pyrrolo[2,3-b]pyridin-3-yl)acetic acid
CAS:Formula:C9H8N2O2Purity:98%Color and Shape:SolidMolecular weight:176.1752-(1H-Pyrrolo[2,3-b]pyridin-3-yl)acetic acid
CAS:2-(1H-Pyrrolo[2,3-b]pyridin-3-yl)acetic acid (2HPAPA) is a molecule that has been optimised for fluorescence. It is being developed as a potential treatment for cancer. The mechanism of action of 2HPAPA is not yet known, but it has shown to have an acidic pH and fluoresce in the presence of oxygen. 2 HPAPA also has clinical development with transition from preclinical to clinical studies.Formula:C9H8N2O2Purity:Min. 95%Molecular weight:176.18 g/mol




