CymitQuimica logo

CAS 19131-13-6

:

6-Deoxy-3-O-methyl-beta-allopyranosyl(1-4)-beta-cymaronic acid delta-lactone

Description:
6-Deoxy-3-O-methyl-beta-allopyranosyl(1-4)-beta-cymaronic acid delta-lactone, identified by its CAS number 19131-13-6, is a complex organic compound that belongs to the class of glycosides and lactones. This substance features a sugar moiety, specifically a deoxy sugar, which is linked to a lactone structure, indicating the presence of a cyclic ester formed from a hydroxy acid. The compound exhibits characteristics typical of glycosides, such as potential solubility in polar solvents due to the sugar component, while the lactone structure may impart unique reactivity and stability properties. Its structural features suggest it may participate in various biochemical interactions, potentially influencing biological pathways. The presence of methyl and deoxy groups can affect its polarity and biological activity, making it of interest in fields such as medicinal chemistry and natural product research. However, specific applications, biological activities, and detailed physicochemical properties would require further investigation through empirical studies.
Formula:C14H24O8
InChI:InChI=1S/C14H24O8/c1-6-10(16)13(19-4)11(17)14(21-6)22-12-7(2)20-9(15)5-8(12)18-3/h6-8,10-14,16-17H,5H2,1-4H3/t6-,7-,8+,10-,11-,12-,13-,14+/m1/s1
InChI key:KDFQTPWOAMJVSY-LYCNJRBKSA-N
SMILES:C[C@@H]1[C@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](OC(=O)C[C@@H]2OC)C)O)OC)O
Synonyms:
  • 6-Deoxy-3-o-methyl-beta-allopyranosyl(1-4)-beta-cymaronic aciddelta-lactone
  • 6-Deoxy-3-O-methyl-beta-allopyranosyl (1-4)-beta-cymaronic acid delta-lactone
Found 3 products.