CAS 1914-58-5
:(3E)-4-Phenyl-3-butenoic acid
Description:
(3E)-4-Phenyl-3-butenoic acid, with the CAS number 1914-58-5, is an organic compound characterized by its unsaturated carboxylic acid structure. It features a phenyl group attached to a butenoic acid backbone, specifically at the 4-position, which contributes to its unique reactivity and properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the double bond in the butenoic acid moiety imparts specific reactivity, making it susceptible to electrophilic addition reactions. Additionally, the carboxylic acid functional group provides acidic properties, allowing it to participate in acid-base reactions. Its solubility in organic solvents and limited solubility in water are typical for compounds of this nature. Overall, (3E)-4-Phenyl-3-butenoic acid is a valuable compound in synthetic organic chemistry, with implications in various chemical processes.
Formula:C10H10O2
InChI:InChI=1S/C10H10O2/c11-10(12)8-4-7-9-5-2-1-3-6-9/h1-7H,8H2,(H,11,12)/b7-4+
InChI key:InChIKey=PSCXFXNEYIHJST-QPJJXVBHSA-N
SMILES:C(=C/CC(O)=O)\C1=CC=CC=C1
Synonyms:- (3E)-4-Phenyl-3-butenoic acid
- (3E)-4-phenylbut-3-enoate
- (3E)-4-phenylbut-3-enoic acid
- (3Z)-4-phenylbut-3-enoic acid
- (E)-4-Phenyl-3-butenoic acid
- 218-814-1
- 3-Butenoic acid, 4-phenyl-, (3E)-
- 3-Butenoic acid, 4-phenyl-, (E)-
- 4-Phenylbut-3-enoic acid
- NSC 172584
- trans-Styrylacetic acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
(E)-4-Phenylbut-3-enoic acid
CAS:Formula:C10H10O2Purity:95%Color and Shape:SolidMolecular weight:162.1852Trans-styrylacetic acid
CAS:Trans-styrylacetic acidFormula:C10H10O2Purity:95%Color and Shape:solidMolecular weight:162.1852trans-Styrylacetic acid
CAS:Trans-styrylacetic acid is a tumorigenic agent. It is an oxidation catalyst and water vapor that binds to the metal hydroxides, inhibiting the hydrogen bond formation. Trans-styrylacetic acid has shown inhibitory properties against inflammatory diseases and cancer. Trans-styrylacetic acid inhibits protein synthesis by binding to dinucleotide phosphate and has been shown to have anti-inflammatory activity in vivo and in vitro. Type strain studies have shown that trans-styrylacetic acid inhibits the growth of cancer cells but not normal cells, indicating its specificity for cancer cells.Formula:C10H10O2Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:162.19 g/moltrans-Styrylacetic acid
CAS:(E)-4-Phenylbut-3-enoic acidFormula:C10H10O2Purity:95%Molecular weight:162.19
