CymitQuimica logo

CAS 19156-51-5

:

5-ethylthiophene-3-carboxylic acid

Description:
5-Ethylthiophene-3-carboxylic acid is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. The presence of an ethyl group at the 5-position and a carboxylic acid functional group at the 3-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow solid and is soluble in polar solvents due to the carboxylic acid group, which can engage in hydrogen bonding. It exhibits acidic behavior, allowing it to participate in various chemical reactions, such as esterification and amidation. The thiophene moiety imparts aromatic stability and can participate in electrophilic substitution reactions. Additionally, 5-ethylthiophene-3-carboxylic acid may have applications in organic synthesis, pharmaceuticals, and materials science due to its functional groups and structural characteristics. Its reactivity and solubility make it a versatile building block in the synthesis of more complex organic molecules.
Formula:C7H8O2S
InChI:InChI=1/C7H8O2S/c1-2-6-3-5(4-10-6)7(8)9/h3-4H,2H2,1H3,(H,8,9)
InChI key:WGPALAIKGVKNGT-UHFFFAOYSA-N
SMILES:CCc1cc(cs1)C(=O)O
Synonyms:
  • 3-Thiophenecarboxylic Acid, 5-Ethyl-
Found 3 products.