CymitQuimica logo

CAS 191723-64-5

:

L-histidine 7-amindo-4-methylcoumarin

Description:
L-histidine 7-amido-4-methylcoumarin is a synthetic compound that serves as a fluorescent probe, particularly useful in biochemical and cellular studies. This compound is characterized by its unique structure, which includes a histidine moiety linked to a 4-methylcoumarin group. The presence of the amido group enhances its solubility and reactivity, making it suitable for various applications in research. L-histidine itself is an essential amino acid involved in protein synthesis and various metabolic processes. The fluorescent properties of this compound allow for its use in tracking and studying enzyme activity, protein interactions, and cellular processes. Additionally, the coumarin derivative contributes to its photostability and emission characteristics, making it a valuable tool in fluorescence microscopy and other analytical techniques. Overall, L-histidine 7-amido-4-methylcoumarin is a versatile compound with significant implications in the fields of biochemistry and molecular biology.
Formula:C16H16N4O3
InChI:InChI=1S/C16H16N4O3/c1-9-4-15(21)23-14-6-10(2-3-12(9)14)20-16(22)13(17)5-11-7-18-8-19-11/h2-4,6-8,13H,5,17H2,1H3,(H,18,19)(H,20,22)/t13-/m0/s1
InChI key:YSUYDFDITKBMJW-ZDUSSCGKSA-N
SMILES:CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](CC3=CN=CN3)N
Synonyms:
  • H-His-AMC
  • H-His-AMC.TFA
Found 3 products.