
CAS 192003-01-3
:L-beta-homotryptophan-HCl
Description:
L-beta-homotryptophan-HCl is a derivative of the amino acid tryptophan, specifically an analog that features a beta substitution on the indole ring. This compound is characterized by its incorporation of a beta carbon in the side chain, which alters its biochemical properties compared to standard tryptophan. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various biochemical applications. L-beta-homotryptophan is of interest in research related to protein synthesis, enzyme activity, and the study of neurotransmitter pathways, given tryptophan's role as a precursor to serotonin. The compound may exhibit unique interactions with biological systems due to its structural modifications, making it a valuable tool in pharmacological and biochemical studies. Additionally, its stability and solubility characteristics can influence its behavior in experimental settings, impacting its utility in drug development and therapeutic applications. As with many amino acid derivatives, the specific stereochemistry and functional groups present in L-beta-homotryptophan-HCl contribute to its distinct biological activity and potential therapeutic effects.
Formula:C12H14N2O2
InChI:InChI=1/C12H14N2O2/c13-9(6-12(15)16)5-8-7-14-11-4-2-1-3-10(8)11/h1-4,7,9,14H,5-6,13H2,(H,15,16)/t9-/m0/s1
SMILES:c1ccc2c(c1)c(C[C@@H](CC(=O)O)N)c[nH]2
Synonyms:- (3S)-3-amino-4-(1H-indol-3-yl)butanoic acid hydrochloride
- (3S)-3-amino-4-(1H-indol-3-yl)butanoic acid
- H-β-HoTrp-OH.HCl
- L-Beta-Homotryptophan Hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(S)-3-Amino-4-(1H-indol-3-yl)butanoic acid
CAS:(S)-3-Amino-4-(1H-indol-3-yl)butanoic acidFormula:C12H14N2O2Purity:95%Molecular weight:218.25(S)-3-Amino-4-(1H-indol-3-yl)butanoic acid
CAS:Formula:C12H14N2O2Purity:95%Color and Shape:SolidMolecular weight:218.2518(S)-beta-Amino-1H-indole-3-butanoic acid
CAS:Please enquire for more information about (S)-beta-Amino-1H-indole-3-butanoic acid including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C12H14N2O2Purity:Min. 95%Molecular weight:218.25 g/mol


