CymitQuimica logo

CAS 192182-54-0

:

3,5-Dimethoxyphenylboronic acid

Description:
3,5-Dimethoxyphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has two methoxy substituents at the 3 and 5 positions. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. It is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the boronic acid group allows for participation in Suzuki-Miyaura cross-coupling reactions, which are valuable in the formation of carbon-carbon bonds. Additionally, the methoxy groups enhance the compound's solubility and stability, while also influencing its electronic properties. 3,5-Dimethoxyphenylboronic acid can be utilized in the development of sensors, drug delivery systems, and as a building block in the synthesis of more complex organic molecules. Its reactivity and functional versatility make it an important compound in both academic research and industrial applications.
Formula:C8H13BO4
InChI:InChI=1/C8H10O2.BH3O2/c1-9-7-4-3-5-8(6-7)10-2;2-1-3/h3-6H,1-2H3;1-3H
InChI key:XUIURRYWQBBCCK-UHFFFAOYSA-N
SMILES:COc1cccc(c1)OC.B(O)O
Synonyms:
  • 3,5-Dimethoxybenzeneboronic Acid
  • Boronic Acid - 1,3-Dimethoxybenzene (1:1)
Found 6 products.