CAS 19228-70-7
:2,6-BIS(CHLOROMETHYL)-P-TOLYL ACETATE
Description:
2,6-Bis(chloromethyl)-p-tolyl acetate, with the CAS number 19228-70-7, is an organic compound characterized by its structure, which includes a p-tolyl group and two chloromethyl substituents on a central carbon atom, along with an acetate functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity due to the presence of chloromethyl groups, which can participate in nucleophilic substitution reactions. The acetate moiety contributes to its potential applications in organic synthesis and as an intermediate in the production of various chemical compounds. Additionally, it may exhibit moderate to low solubility in water but is generally soluble in organic solvents. Safety precautions are necessary when handling this compound, as it may pose health risks due to its chlorinated nature. Proper storage and handling in a well-ventilated area, along with the use of personal protective equipment, are recommended to mitigate exposure risks.
Formula:C6H5FN2O2
InChI:InChI=1/C6H5FN2O2/c1-4-2-6(7)8-3-5(4)9(10)11/h2-3H,1H3
SMILES:Cc1cc(F)ncc1N(=O)=O
Synonyms:- 2,6-Bis(Chloromethyl)-4-Tolyl Acetate
- 2,6-Bis(chloromethyl)-4-methylphenyl acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
