CymitQuimica logo

CAS 19230-27-4

:

1,3-dibromo-2-chlorobenzene

Description:
1,3-Dibromo-2-chlorobenzene is an aromatic halogenated compound characterized by the presence of two bromine atoms and one chlorine atom attached to a benzene ring. The molecular structure features bromine substituents at the 1 and 3 positions and a chlorine substituent at the 2 position, which influences its chemical reactivity and physical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its moderate solubility in organic solvents and limited solubility in water, which is common for halogenated aromatic compounds. 1,3-Dibromo-2-chlorobenzene can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it useful in organic synthesis and as an intermediate in the production of other chemical compounds. Safety precautions should be taken when handling this substance, as it may pose health risks, including potential toxicity and environmental hazards.
Formula:C6H3Br2Cl
InChI:InChI=1/C6H3Br2Cl/c7-4-2-1-3-5(8)6(4)9/h1-3H
InChI key:IRPWVEBIMPXCAZ-UHFFFAOYSA-N
SMILES:c1cc(c(c(c1)Br)Cl)Br
Synonyms:
  • Benzene, 1,3-dibromo-2-chloro-
  • 2,6-Dibromochlorobenzene
  • 1-Chloro-2,6-dibromobenzene
Found 5 products.