CymitQuimica logo

CAS 192323-70-9

:

[1,1'-Biphenyl]-3-carboxylicacid, 4-amino-4'-methyl-

Description:
[1,1'-Biphenyl]-3-carboxylic acid, 4-amino-4'-methyl- is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a carboxylic acid functional group (-COOH) at the 3-position of one phenyl ring and an amino group (-NH2) along with a methyl group (-CH3) at the 4' position of the other phenyl ring. The presence of these functional groups contributes to its potential as a building block in organic synthesis and pharmaceuticals. The compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid and amino groups, which can engage in hydrogen bonding. Additionally, the biphenyl structure may impart certain electronic properties, influencing its reactivity and interactions in chemical reactions. Overall, this compound's unique structure and functional groups make it of interest in various chemical applications, including drug development and materials science.
Formula:C14H13NO2
InChI:InChI=1S/C14H13NO2/c1-9-2-4-10(5-3-9)11-6-7-13(15)12(8-11)14(16)17/h2-8H,15H2,1H3,(H,16,17)
InChI key:SURZAQVAAPZGFF-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)C2=CC(=C(C=C2)N)C(=O)O
Found 2 products.