CymitQuimica logo

CAS 19241-34-0

:

2-Chloro-6-methylphenyl isothiocyanate

Description:
2-Chloro-6-methylphenyl isothiocyanate is an organic compound characterized by the presence of an isothiocyanate functional group attached to a chlorinated aromatic ring. Its molecular structure features a phenyl ring substituted with a chlorine atom at the 2-position and a methyl group at the 6-position, contributing to its unique reactivity and properties. This compound is typically a yellow to brown liquid with a pungent odor, indicative of the isothiocyanate group, which is known for its potential biological activity. It is soluble in organic solvents but has limited solubility in water. 2-Chloro-6-methylphenyl isothiocyanate is often used in chemical synthesis and research, particularly in the development of agrochemicals and pharmaceuticals. Its reactivity allows it to participate in various chemical reactions, including nucleophilic substitutions and additions, making it a valuable intermediate in organic synthesis. As with many isothiocyanates, it may exhibit antimicrobial and anticancer properties, although handling precautions are necessary due to its potential irritant effects.
Formula:C8H6ClNS
InChI:InChI=1/C8H6ClNS/c1-6-3-2-4-7(9)8(6)10-5-11/h2-4H,1H3
InChI key:MLQPKPCDKLACIG-UHFFFAOYSA-N
SMILES:Cc1cccc(c1N=C=S)Cl
Synonyms:
  • 6-Chloro-2-Methylphenylisocyanate
  • 2-Chloro-6-Methylphenyl Isocyanate
  • 2-Chloro-6-methylphenyl isothiocyanate, 95+%
  • 2-Chloro-6-Methylphenyl Isothiocyanate 98%
  • 1-Chloro-2-Isothiocyanato-3-Methylbenzene
  • 2-Chloro-6 Methyl Phenyl Isothiocynate
Found 4 products.