CAS 192508-36-4
:(4-Fluoro-3-nitrophenyl)acetic acid
Description:
(4-Fluoro-3-nitrophenyl)acetic acid is an organic compound characterized by the presence of both a fluoro and a nitro group on a phenyl ring, along with a carboxylic acid functional group. Its molecular structure features a phenyl ring substituted at the para position with a fluorine atom and at the meta position with a nitro group, which influences its reactivity and polarity. The carboxylic acid group contributes to its acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique substituents can affect its solubility in different solvents, as well as its interaction with biological systems, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as compounds with nitro and fluoro groups can exhibit specific hazards.
Formula:C8H6FNO4
InChI:InChI=1/C8H6FNO4/c9-6-2-1-5(4-8(11)12)3-7(6)10(13)14/h1-3H,4H2,(H,11,12)
SMILES:c1cc(c(cc1CC(=O)O)N(=O)=O)F
Synonyms:- Benzeneacetic Acid, 4-Fluoro-3-Nitro-
- 3-Nitro-4-fluorophenylaceticacid
- 4-Fluoro-3-Nitrophenylacetic Acid
- 3-Nitro-4-Fluorophenylacetic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(4-Fluoro-3-nitrophenyl)acetic acid
CAS:Formula:C8H6FNO4Purity:98%Color and Shape:SolidMolecular weight:199.13592-(4-Fluoro-3-nitrophenyl)acetic acid
CAS:2-(4-Fluoro-3-nitrophenyl)acetic acidFormula:C8H6FNO4Purity:98%Molecular weight:199.144-Fluoro-3-nitrophenylacetic acid
CAS:Formula:C8H6FNO4Purity:95%Color and Shape:SolidMolecular weight:199.1372-(4-Fluoro-3-nitrophenyl)acetic acid
CAS:2-(4-Fluoro-3-nitrophenyl)acetic acidFormula:C8H6FNO4Purity:98%Molecular weight:199.144-Fluoro-3-nitrophenylacetic acid
CAS:4-Fluoro-3-nitrophenylacetic acid is a chiral monomer that can be used to synthesize diphenyl ethers. The reaction requires a carbamic acid as the acid catalyst and a nucleophilic reagent, such as an amine. 4-Fluoro-3-nitrophenylacetic acid has been shown to have anti-cancer properties in vitro and in vivo. 4-Fluoro-3-nitrophenylacetic acid may also inhibit the synthesis of dihydroisoquinolines, which are important for the function of DNA polymerase. There are two strategies for synthesizing this compound: one is based on the condensation of two molecules of phenylacetaldehyde in the presence of an acid catalyst; the other employs a Lewis acid catalyst with a pyridine nucleophile.Formula:C8H6FNO4Purity:Min. 95%Color and Shape:SolidMolecular weight:199.14 g/mol




